Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_4D2B3695B5 | PHLORIDZIN | [M+Na]+ | 459.1261 | 194.4 | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_2F8030EB81 | PHLORETIN | [M+H]+ | 275.0914 | 160.7 | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O)O)O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_EA129538AE | BRAZILEIN | [M+H]+ | 285.0758 | 159.9 | C1C2=CC(=C(C=C2C3=C4C=CC(=O)C=C4OCC31O)O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_D46F6761C1 | PROXYPHYLLINE | [M+H]+ | 239.1139 | 149.1 | CC(CN1C=NC2=C1C(=O)N(C(=O)N2C)C)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_B193DDB690 | CETYLPYRIDINIUM CHLORIDE | [M+H]+ | 304.3004 | 197.5 | CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1.[Cl-] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_0966C935FE | CHOLEST-5-EN-3-ONE | [M+H]+ | 385.3465 | 211.4 | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CCC(=O)C4)C)C | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_EAE705517A | GABAPENTIN | [M+H]+ | 172.1332 | 138.6 | C1CCC(CC1)(CC(=O)O)CN | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_E098CDE9F3 | BISACODYL | [M+H]+ | 362.1387 | 193.3 | CC(=O)OC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC(=O)C)C3=CC=CC=N3 | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_C13C8E5357 | METHOTREXATE | [M+H]+ | 455.1786 | 194.8 | CN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_70CB0EB0BB | CYCLOPHOSPHAMIDE HYDRATE | [M+H]+ | 261.0321 | 146.5 | C1CNP(=O)(OC1)N(CCCl)CCCl.O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |