Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_6741B0970E | BROMHEXINE HYDROCHLORIDE | [M+H]+ | 375.0066 | 168.5 | CN(CC1=CC(=CC(=C1N)Br)Br)C2CCCCC2.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_F7EDA798CE | MERCAPTOPURINE | [M+H]+ | 153.023 | 125.5 | C1=NC2=C(N1)C(=S)N=CN2 | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_4AE354A778 | QUININE SULFATE | [M+H]+ | 325.1911 | 176.0 | COC1=CC2=C(C=CN=C2C=C1)[C@H]([C@@H]3C[C@@H]4CCN3C[C@@H]4C=C)O.OS(=O)(=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_88FDF9DA7F | SULCONAZOLE NITRATE | [M+H]+ | 397.0095 | 184.4 | C1=CC(=CC=C1CSC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl.[N+](=O)(O)[O-] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_8AB46EC621 | AMOXICILLIN | [M+H]+ | 366.1118 | 187.4 | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)C(=O)O)C | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_FD2D4F9710 | TRIPELENNAMINE CITRATE | [M+H]+ | 256.1808 | 159.5 | CN(C)CCN(CC1=CC=CC=C1)C2=CC=CC=N2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_93D5076662 | TRIPROLIDINE HYDROCHLORIDE | [M+H]+ | 279.1856 | 169.0 | CC1=CC=C(C=C1)/C(=C\CN2CCCC2)/C3=CC=CC=N3.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_8DD554ABCC | OXYTHIAMINE CHLORIDE HYDROCHLORIDE | [M]+ | 266.0963 | 157.7 | CC1=C(SC=[N+]1CC2=CN=C(NC2=O)C)CCO.Cl.[Cl-] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_3BA0754F18 | PROCAINAMIDE HYDROCHLORIDE | [M+H]+ | 236.1758 | 155.8 | CCN(CC)CCNC(=O)C1=CC=C(C=C1)N.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_382C357D71 | QUINACRINE HYDROCHLORIDE | [M+H]+ | 400.215 | 195.7 | CCN(CC)CCCC(C)NC1=C2C=C(C=CC2=NC3=C1C=CC(=C3)Cl)OC.Cl.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |