Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_CB4F1D7940 | RIZATRIPTAN BENZOATE | [M+H]+ | 270.1713 | 160.6 | CN(C)CCC1=CNC2=C1C=C(C=C2)CN3C=NC=N3.C1=CC=C(C=C1)C(=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_7E0E80C34E | FEBUXOSTAT | [M+H]+ | 317.0955 | 180.6 | CC1=C(SC(=N1)C2=CC(=C(C=C2)OCC(C)C)C#N)C(=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_1E42F0B6C0 | HAEMATOPORPHYRIN | [M+H]+ | 599.2864 | 248.4 | CC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5)C=C1N2)C(C)O)C)C(=C4CCC(=O)O)C)C(=C3C)CCC(=O)O)C(C)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_5C9BCEAD6F | OLMESARTAN MEDOXOMIL | [M+H]+ | 559.23 | 225.0 | CCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4)C(=O)OCC5=C(OC(=O)O5)C)C(C)(C)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_340201F738 | CHOLIC ACID, METHYL ESTER | [M+Na]+ | 445.2924 | 198.1 | C[C@H](CCC(=O)OC)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_43158B00B9 | SODIUM DEHYDROCHOLATE | [M+Na]+ | 425.2298 | 192.1 | C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C.[Na+] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_CF3F6DAE54 | FLUPHENAZINE HYDROCHLORIDE | [M+H]+ | 438.1822 | 197.5 | C1CN(CCN1CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F)CCO.Cl.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_B6E6BD0278 | SELEGILINE HYDROCHLORIDE | [M+H]+ | 188.1434 | 141.0 | C[C@H](CC1=CC=CC=C1)N(C)CC#C.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_E4545B092B | TODRALAZINE HYDROCHLORIDE | [M+H]+ | 233.1033 | 150.0 | CCOC(=O)NNC1=NN=CC2=CC=CC=C21.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_FA6407A2BE | OXOLINIC ACID | [M+H]+ | 262.071 | 149.1 | CCN1C=C(C(=O)C2=CC3=C(C=C21)OCO3)C(=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |