Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_53CA1E11AB | TROPICAMIDE | [M+H]+ | 285.1598 | 169.5 | CCN(CC1=CC=NC=C1)C(=O)C(CO)C2=CC=CC=C2 | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_6F29ECFA7F | PROCYCLIDINE HYDROCHLORIDE | [M+H]+ | 288.2322 | 171.5 | C1CCC(CC1)C(CCN2CCCC2)(C3=CC=CC=C3)O.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_D8027A80E3 | BETAMETHAZONE SODIUM PHOSPHATE | [M+H]+ | 473.1735 | 201.1 | C[C@H]1CC2C3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COP(=O)([O-])[O-])O)C)O)F)C | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_C70DC9AB30 | MONTELUKAST SODIUM | [M+H]+ | 586.2182 | 227.6 | CC(C)(C1=CC=CC=C1CC[C@H](C2=CC=CC(=C2)/C=C/C3=NC4=C(C=CC(=C4)Cl)C=C3)SCC5(CC5)CC(=O)[O-])O.[Na+] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_E3D5D36DA9 | MONTELUKAST SODIUM | [M+H]+ | 586.2182 | 243.2 | CC(C)(C1=CC=CC=C1CC[C@H](C2=CC=CC(=C2)/C=C/C3=NC4=C(C=CC(=C4)Cl)C=C3)SCC5(CC5)CC(=O)[O-])O.[Na+] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_0108461CD3 | VERAPAMIL HYDROCHLORIDE | [M+H]+ | 455.2905 | 208.9 | CC(C)C(CCCN(C)CCC1=CC(=C(C=C1)OC)OC)(C#N)C2=CC(=C(C=C2)OC)OC.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_BC6EADD715 | FLURANDRENOLIDE | [M+H]+ | 437.2334 | 201.2 | C[C@]12CCC(=O)C=C1[C@H](C[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3C[C@@H]5[C@]4(OC(O5)(C)C)C(=O)CO)C)O)F | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_50504531FA | RUTOSIDE (rutin) | [M+H]+ | 611.1607 | 230.7 | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H](C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_6CEB67AEE9 | DICLOFENAC SODIUM | [M+H]+ | 296.0245 | 157.2 | C1=CC=C(C(=C1)CC(=O)[O-])NC2=C(C=CC=C2Cl)Cl.[Na+] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_938271B09C | THIAMPHENICOL | [M+H]+ | 356.0121 | 170.7 | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |