Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_0F9A402D2F | Lithocholic acid | [M-H]- | 375.2896 | 200.33 | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C | small molecule | 1 | 10 | DT | stepped-field | |
| CCSBASE_2E5025B463 | Ursodeoxycholic acid | [M-H]- | 471.2416 | 208.98 | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C | small molecule | 1 | 10 | DT | stepped-field | |
| CCSBASE_DF8D307F26 | Cholic acid | [M-H]- | 407.2797 | 204.63 | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C | small molecule | 1 | 10 | DT | stepped-field | |
| CCSBASE_B83085F24D | Hyocholic acid | [M-H]- | 407.2797 | 206.0 | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H]([C@@H]([C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C | small molecule | 1 | 10 | DT | stepped-field | |
| CCSBASE_96CA55CF32 | Ursocholic acid | [M-H]- | 407.2797 | 205.1 | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C | small molecule | 1 | 10 | DT | stepped-field | |
| CCSBASE_7CBDCE664F | _-Muricholic acid | [M-H]- | 407.2797 | 207.44 | None | small molecule | 1 | 10 | DT | stepped-field | |
| CCSBASE_364BFBF3F5 | _-Muricholic acid | [M-H]- | 407.2797 | 203.02 | None | small molecule | 1 | 10 | DT | stepped-field | |
| CCSBASE_86AF26A8CA | Sulfolithocholic acid | [M-H]- | 455.2467 | 212.2 | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)OS(=O)(=O)O)C)C | small molecule | 1 | 10 | DT | stepped-field | |
| CCSBASE_A0C8F9481B | Glycocholic acid hydrate | [M-H]- | 544.258 | 219.31 | C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3C2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C | small molecule | 1 | 10 | DT | stepped-field | |
| CCSBASE_70D5DF1DF8 | Glycodeoxycholic acid | [M-H]- | 528.2631 | 218.94 | C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C | small molecule | 1 | 10 | DT | stepped-field |