Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_594DFEFDFC | Lauric acid | [M-H]- | 199.1704 | 154.96 | CCCCCCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_9F0E39BB04 | Pentadecylic acid | [M-H]- | 241.2173 | 165.59 | CCCCCCCCCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_6D76EF8177 | Palmitoleic acid | [M-H]- | 253.2173 | 167.86 | CCCCCC/C=C\CCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_1CBAEA3C69 | Palmitic acid | [M-H]- | 255.233 | 169.17 | CCCCCCCCCCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_0CA78FC258 | Heptadecanoic acid | [M-H]- | 269.2486 | 173.49 | CCCCCCCCCCCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_6D39F5B6B3 | Linlenic acid | [M-H]- | 277.2173 | 174.53 | None | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_14972A9B97 | Linoleic acid | [M-H]- | 279.233 | 175.37 | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_D080C1E4C5 | Oleic acid | [M-H]- | 281.2486 | 176.07 | CCCCCCCC/C=C\CCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_0727DA751E | Stearic acid | [M-H]- | 283.2643 | 177.95 | CCCCCCCCCCCCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_B66925DC88 | Arachidonic acid | [M-H]- | 303.233 | 182.21 | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field |