Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_2064733A17 | Lipoxin A4 | [M+Na]+ | 375.2141802 | 197.891372 | CCCCC[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_5D21B57855 | Prostaglandin E2 | [M+Na]+ | 375.2141802 | 198.5281432 | CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1C/C=C\CCCC(=O)O)O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_5CF8897D08 | 8-iso-Prostaglandin F2 alpha | [M+Na]+ | 377.2298294 | 199.0307973 | CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@@H]([C@H]1C/C=C\CCCC(=O)O)O)O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_F4FCAE8FDE | Prostaglandin G2 | [M+Na]+ | 391.2096472 | 199.3 | CCCCC[C@@H](/C=C/[C@H]1[C@H]2C[C@@H]([C@@H]1C/C=C\CCCC(=O)O)OO2)OO | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_F6233F2E9E | Riboflavin | [M+Na]+ | 399.127496 | 199.399435 | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)C[C@@H]([C@@H]([C@@H](CO)O)O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_949139F489 | 9-OxoODE | [M+Na]+ | 317.20925 | 199.5 | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_57FDC67FB8 | Arachidic Acid | [M+Na]+ | 335.2921 | 199.9691476 | CCCCCCCCCCCCCCCCCCCC(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_5589BDCC32 | 5-Methyltetrahydrofolate | [M+Na]+ | 482.17573 | 200.0361726 | CN1C(CNC2=C1C(=O)N=C(N2)N)CNC3=CC=C(C=C3)C(=O)N[C@H](CCC(=O)O)C(=O)O | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_0D2A657BCB | 11B-Prostaglandin F2 alpha | [M+Na]+ | 377.2373 | 200.2 | None | small molecule | 1 | 10 | DT | stepped-field | |
CCSBASE_408A05C1EF | Resolvin D2 | [M+Na]+ | 399.21473 | 200.6 | CC/C=C\C[C@@H]([C@@H](/C=C/C=C/C=C\C=C\[C@H](C/C=C\CCC(=O)O)O)O)O | small molecule | 1 | 10 | DT | stepped-field |