Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_F5B410B894 | Lauric acid | [M-H]- | 199.16983 | 154.82 | CCCCCCCCCCCC(=O)O | small molecule | 1 | 8 | DT | stepped-field | |
| CCSBASE_41B247793B | L-Cystine | [M-H]- | 239.01605 | 144.39 | C([C@@H](C(=O)O)N)SSC[C@@H](C(=O)O)N | small molecule | 1 | 8 | DT | stepped-field | |
| CCSBASE_88016E0D97 | Pentadecanoic acid | [M-H]- | 241.21678 | 165.34 | CCCCCCCCCCCCCCC(=O)O | small molecule | 1 | 8 | DT | stepped-field | |
| CCSBASE_4645130DBE | Pyridoxal Phosphate | [M-H]- | 246.01677 | 150.8 | CC1=NC=C(C(=C1O)C=O)COP(=O)(O)O | small molecule | 1 | 8 | DT | stepped-field | |
| CCSBASE_A8FF00F583 | Palmitoleic acid | [M-H]- | 253.21678 | 167.95 | CCCCCC/C=C\CCCCCCCC(=O)O | small molecule | 1 | 8 | DT | stepped-field | |
| CCSBASE_8AC7F2614E | Palmitic acid | [M-H]- | 255.23243 | 169.12 | CCCCCCCCCCCCCCCC(=O)O | small molecule | 1 | 8 | DT | stepped-field | |
| CCSBASE_4DC1A3729C | Margaric acid | [M-H]- | 269.24808 | 173.41 | CCCCCCCCCCCCCCCCC(=O)O | small molecule | 1 | 8 | DT | stepped-field | |
| CCSBASE_27AB4AA582 | Linolenic acid | [M-H]- | 277.21678 | 174.88 | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O | small molecule | 1 | 8 | DT | stepped-field | |
| CCSBASE_B61A049640 | Linoleic acid | [M-H]- | 279.23243 | 175.69 | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O | small molecule | 1 | 8 | DT | stepped-field | |
| CCSBASE_15D3F5C597 | Oleic acid | [M-H]- | 281.24808 | 176.46 | CCCCCCCC/C=C\CCCCCCCC(=O)O | small molecule | 1 | 8 | DT | stepped-field |