Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_CB32D1125A | CHOLIC ACID | [M+Na]+ | 431.2768 | 195.6 | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_2D6986EEBD | WARFARIN | [M+H]+ | 309.1122 | 165.9 | CC(=O)CC(C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_2302A11D58 | D-LACTITOL MONOHYDRATE | [M+Na]+ | 367.1211 | 173.1 | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@H]([C@@H](CO)O)[C@@H]([C@H](CO)O)O)O)O)O)O.O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_F393C594EA | CLARITHROMYCIN | [M+H]+ | 748.4842 | 264.2 | CC[C@@H]1[C@@]([C@@H]([C@H](C(=O)[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)OC)C)C)O)(C)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_E6B9312200 | PRAVASTATIN SODIUM | [M+Na]+ | 447.2353 | 205.2 | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@H](C[C@H](CC(=O)[O-])O)O)O.[Na+] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_24EEFD6D61 | ALFLUZOSIN | [M+H]+ | 390.2136 | 193.9 | CN(CCCNC(=O)C1CCCO1)C2=NC3=CC(=C(C=C3C(=N2)N)OC)OC | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_CBF0B679F3 | 2',4'-DIHYDROXY-4-METHOXYCHALCONE | [M+H]+ | 271.0965 | 162.2 | COC1=CC=C(C=C1)/C=C/C(=O)C2=C(C=C(C=C2)O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_8440F6BB44 | BAMBUTEROL HYDROCHLORIDE | [M+H]+ | 368.218 | 189.2 | CC(C)(C)NCC(C1=CC(=CC(=C1)OC(=O)N(C)C)OC(=O)N(C)C)O.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_BEFE920EC5 | CAFESTOL ACETATE | [M+H]+ | 359.2217 | 169.3 | CC(=O)OCC1(CC23CCC4C5=C(CCC4(C2CCC1C3)C)OC=C5)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_2CA142C005 | VISNAGIN | [M+H]+ | 231.0652 | 139.1 | CC1=CC(=O)C2=C(O1)C=C3C(=C2OC)C=CO3 | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |