Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_00C1F125E5 | CACODYLIC ACID | [M+H]+ | 138.9735 | 112.5 | C[As](=O)(C)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_ED175E8356 | 4-O-METHYLPHLORACETOPHENONE | [M+H]+ | 183.0652 | 130.5 | CC(=O)C1=C(C=C(C=C1O)OC)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_CF1866A613 | LOVASTATIN | [M+Na]+ | 427.2455 | 202.0 | CC[C@H](C)C(=O)O[C@H]1C[C@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@@H]3C[C@H](CC(=O)O3)O)C | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_E91ADB8ACD | PIRENPERONE | [M+H]+ | 394.1926 | 196.8 | CC1=C(C(=O)N2C=CC=CC2=N1)CCN3CCC(CC3)C(=O)C4=CC=C(C=C4)F | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_968B27DA87 | FLUDARABINE PHOSPHATE | [M+H]+ | 366.061 | 168.8 | C1=NC2=C(N1[C@H]3[C@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N=C(N=C2N)F | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_4020DD4682 | TRIAMCINOLONE ACETONIDE | [M+H]+ | 435.2178 | 197.1 | C[C@]12C[C@@H]([C@]3([C@H]([C@@H]1C[C@@H]4[C@]2(OC(O4)(C)C)C(=O)CO)CCC5=CC(=O)C=C[C@@]53C)F)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_824F3BA311 | MEPENZOLATE BROMIDE | [M+H]+ | 341.1986 | 180.7 | C[N+]1(CCCC(C1)OC(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)O)C.[Br-] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_DD7E3FDE6A | ENALAPRIL MALEATE | [M+H]+ | 377.2071 | 186.6 | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O.C(=C\C(=O)O)\C(=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_241CE7F883 | FLORFENICOL | [M+Na]+ | 379.9897 | 170.7 | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)NC(=O)C(Cl)Cl)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_96D83CC0EE | RONIDAZOLE | [M+H]+ | 201.0619 | 136.9 | CN1C(=CN=C1COC(=O)N)[N+](=O)[O-] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |