Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_8BE9FBC89E | COLCHICINE | [M+H]+ | 400.1755 | 194.5 | CC(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_DB27FD0EBC | ZOMEPIRAC SODIUM | [M+H]+ | 292.0735 | 164.6 | CC1=C(N(C(=C1)CC(=O)[O-])C)C(=O)C2=CC=C(C=C2)Cl.[Na+] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_3110C697CC | ANTIAROL | [M+H]+ | 185.0809 | 133.5 | COC1=CC(=CC(=C1OC)OC)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_D742456D36 | OXICONAZOLE NITRATE | [M+H]+ | 427.9886 | 193.1 | C1=CC(=C(C=C1Cl)Cl)CO/N=C(\CN2C=CN=C2)/C3=C(C=C(C=C3)Cl)Cl.[N+](=O)(O)[O-] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_9D5FFEFA37 | ERYTHROMYCIN STEARATE | [M+H]+ | 734.4685 | 258.5 | CCCCCCCCCCCCCCCCCC(=O)O.CC[C@@H]1[C@@]([C@@H]([C@H](C(=O)[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)C)C)O)(C)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_F54BC9EE11 | CEFOTAXIME SODIUM | [M+H]+ | 456.0642 | 196.6 | CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)/C(=N\OC)/C3=CSC(=N3)N)SC1)C(=O)[O-].[Na+] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_671D693B1B | TOLMETIN SODIUM | [M+H]+ | 258.113 | 158.7 | CC1=CC=C(C=C1)C(=O)C2=CC=C(N2C)CC(=O)[O-].[Na+] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_FC9EA4664C | ALTRETAMINE | [M+H]+ | 211.1666 | 145.6 | CN(C)C1=NC(=NC(=N1)N(C)C)N(C)C | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_0DC4F5506D | CEFUROXIME AXETIL | [M+Na]+ | 447.0581 | 189.7 | CC(OC(=O)C)OC(=O)C1=C(CS[C@H]2N1C(=O)[C@H]2NC(=O)/C(=N\OC)/C3=CC=CO3)COC(=O)N | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_A831C0BBA3 | ISOGUVACINE HYDROCHLORIDE | [M+H]+ | 128.0706 | 128.5 | C1CNCC=C1C(=O)O.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |