Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_91DC268871 | CHLOROQUINE DIPHOSPHATE | [M+H]+ | 320.1888 | 175.6 | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.OP(=O)(O)O.OP(=O)(O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_12AC36721D | CAMYLOFINE DIHYDROCHLORIDE | [M+H]+ | 321.2537 | 183.1 | CCN(CC)CCNC(C1=CC=CC=C1)C(=O)OCCC(C)C.Cl.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_DF4C83AAD8 | FUROSEMIDE | [M+H]+ | 331.015 | 169.3 | C1=COC(=C1)CNC2=CC(=C(C=C2C(=O)O)S(=O)(=O)N)Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_19F67B4D3D | MOXISYLYTE HYDROCHORIDE | [M+H]+ | 280.1907 | 166.3 | CC1=CC(=C(C=C1OC(=O)C)C(C)C)OCCN(C)C.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_1175A8BBF2 | AMINOPTERIN | [M+H]+ | 441.163 | 204.4 | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=NC(=N3)N)N | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_5AF84D518A | PRONETALOL HYDROCHLORIDE | [M+H]+ | 230.154 | 156.5 | CC(C)NCC(C1=CC2=CC=CC=C2C=C1)O.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_437082EAE1 | ISONIAZID | [M+H]+ | 138.0662 | 125.6 | C1=CN=CC=C1C(=O)NN | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_A0711364DE | IPRONIAZID SULFATE | [M+H]+ | 180.1132 | 142.2 | CC(C)NNC(=O)C1=CC=NC=C1.OS(=O)(=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_1A6A8A48A8 | PENTYLENETETRAZOL | [M+H]+ | 139.0978 | 124.5 | C1CCC2=NN=NN2CC1 | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_CC9BFF585A | SULOCTIDIL | [M+H]+ | 338.2512 | 197.3 | CCCCCCCCNC(C)C(C1=CC=C(C=C1)SC(C)C)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |