Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_BB4A0C2542 | 4'-METHOXYCHALCONE | [M+H]+ | 239.1067 | 153.8 | COC1=CC=C(C=C1)C(=O)/C=C/C2=CC=CC=C2 | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_E31029920F | TERBUTALINE HEMISULFATE | [M+H]+ | 226.1438 | 153.9 | CC(C)(C)NCC(C1=CC(=CC(=C1)O)O)O.CC(C)(C)NCC(C1=CC(=CC(=C1)O)O)O.OS(=O)(=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_256BADA8AC | SINENSETIN | [M+H]+ | 373.1282 | 186.4 | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)OC)OC)OC | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_35B37F48FC | XYLAZINE | [M+H]+ | 221.1107 | 147.8 | CC1=C(C(=CC=C1)C)NC2=NCCCS2 | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_8FB18C64F8 | METHYLXANTHOXYLIN | [M+H]+ | 211.0965 | 140.2 | CC1=C(C=C(C(=C1O)C(=O)C)OC)OC | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_165EBEE1D1 | OXYMETAZOLINE HYDROCHLORIDE | [M+H]+ | 261.1962 | 169.9 | CC1=CC(=C(C(=C1CC2=NCCN2)C)O)C(C)(C)C.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_881EEA9041 | DOXORUBICIN | [M+H]+ | 544.1814 | 227.0 | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)CO)O)N)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_71D32BDC47 | RITODRINE HYDROCHLORIDE | [M+H]+ | 288.1594 | 166.5 | C[C@@H]([C@@H](C1=CC=C(C=C1)O)O)NCCC2=CC=C(C=C2)O.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_1D1BA26C61 | GUANABENZ ACETATE | [M+H]+ | 231.0199 | 147.8 | CC(=O)O.C1=CC(=C(C(=C1)Cl)/C=N/N=C(N)N)Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_57F6F85DD1 | NALBUPHINE HYDROCHLORIDE | [M+H]+ | 358.2013 | 180.8 | C1CC(C1)CN2CC[C@]34[C@@H]5[C@H](CC[C@]3([C@H]2CC6=C4C(=C(C=C6)O)O5)O)O.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |