Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_E16FDC360A | CEFTRIAXONE SODIUM TRIHYDRATE | [M+H]+ | 555.0534 | 212.3 | CN1C(=NC(=O)C(=N1)[O-])SCC2=C(N3[C@@H]([C@@H](C3=O)NC(=O)/C(=N/OC)/C4=CSC(=N4)N)SC2)C(=O)[O-].[Na+].[Na+] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_C0F2E06F94 | CHRYSANTHEMIC ACID | [M+H]+ | 169.1223 | 130.0 | CC(=CC1C(C1(C)C)C(=O)O)C | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_0597D5C182 | BROMPERIDOL | [M+H]+ | 420.0969 | 194.9 | C1CN(CCC1(C2=CC=C(C=C2)Br)O)CCCC(=O)C3=CC=C(C=C3)F | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_6A0DA2F4ED | NATEGLINIDE | [M+H]+ | 318.2064 | 178.6 | CC(C)C1CCC(CC1)C(=O)N[C@H](CC2=CC=CC=C2)C(=O)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_778B101678 | N-ACETYLMURAMIC ACID | [M+Na]+ | 316.1003 | 164.8 | C[C@H](C(=O)O)O[C@H]1[C@@H]([C@H](OC([C@@H]1NC(=O)C)O)CO)O | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_E31A162364 | PARACHLOROPHENOL | [M+H]+ | 129.0102 | 108.8 | C1=CC(=CC=C1O)Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_FF6CB24BFF | PALMATINE CHLORIDE | [M+H]+ | 353.1622 | 185.6 | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC.[Cl-] | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_4EA613D573 | ETHAMBUTOL HYDROCHLORIDE | [M+H]+ | 205.1911 | 147.0 | CC[C@@H](CO)NCCN[C@@H](CC)CO.Cl.Cl | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_95F773EB98 | PERINDOPRIL ERBUMINE | [M+H]+ | 369.2384 | 188.8 | CCC[C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@H]2CCCC[C@H]2C[C@H]1C(=O)O.CC(C)(C)N | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
CCSBASE_F3DD4BB79A | 3-METHYLXANTHINE | [M+H]+ | 167.0564 | 127.9 | CN1C2=C(C(=O)NC1=O)NC=N2 | small molecule | 1 | 7 | TW | calibrated with polyalanine and drug standards |