Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_2E167B938B | Chlorogenic acid | [M+Na-2H]- | 375.0693 | 173.7872481 | C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_7CE62A5AAC | trans-Vaccenic acid | [M-H]- | 281.2481 | 174.9455271 | CCCCCC/C=C/CCCCCCCCCC(=O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_7A804C82A4 | Rutin | [M-H]- | 609.1456 | 231.0430868 | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_094FAB36C8 | Nicotinuric acid | [M-H]- | 179.0457 | 138.0751719 | C1=CC(=CN=C1)C(=O)NCC(=O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_2E87F7157F | Indole-3-carboxylic acid | [M-H]- | 160.0399 | 124.5006694 | C1=CC=C2C(=C1)C(=CN2)C(=O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_AD09191572 | 1-Methyladenosine | [M-H]- | 280.1046 | 159.2134022 | CN1C=NC2=C(C1=N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_F813F9E823 | 3-Methoxy-4-Hydroxyphenylglycol Sulfate | [M-H]- | 263.0226 | 152.9389133 | COC1=C(C=CC(=C1)C(CO)OS(=O)(=O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_20FFEF7AD0 | Inosine diphosphate | [M-H]- | 427.0056 | 176.1330726 | C1=NC(=O)C2=C(N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_3CD89DF44F | GDP-glucose | [M-H]- | 604.0694 | 208.7249254 | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)O[C@@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)NC(=NC2=O)N | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_D338DD8CE0 | 5-Aminopentanoic acid | [M-H]- | 116.0712 | 124.4921533 | C(CCN)CC(=O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) |