Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_F10E36AFD2 | Glycodeoxycholic acid | [M-H]- | 448.3063 | 197.8149202 | C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_F7DDF3D401 | Glycochenodeoxycholate | [M-H]- | 448.3063 | 198.8475699 | C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_A982141A8D | Dodecanoic acid | [M-H]- | 199.1698 | 152.5839981 | CCCCCCCCCCCC(=O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_021C0D0AAF | D-Galactarate | [M-H]- | 209.0298 | 130.2370434 | [C@@H]([C@@H]([C@H](C(=O)O)O)O)([C@@H](C(=O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_26BF59B5BE | a-D-Galactose 1-phosphate | [M-H]- | 259.0219 | 145.3204351 | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)OP(=O)(O)O)O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_3082A96B4A | Cholesteryl sulfate | [M-H]- | 465.3039 | 237.0061504 | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C)C | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_8DA1DDED8B | Glutaric acid | [M-H]- | 131.0344 | 120.0797202 | C(CC(=O)O)CC(=O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_3BF2C9E380 | D-Glucarate | [M-H]- | 209.0298 | 130.50476 | [C@H]([C@@H]([C@@H](C(=O)O)O)O)([C@H](C(=O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_C8C9135439 | Indolelactic acid | [M-H]- | 204.0661 | 146.5117016 | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_BC3E141683 | Linoleic acid | [M-H]- | 279.2324 | 173.2440901 | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) |