Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
---|---|---|---|---|---|---|---|---|---|---|---|
CCSBASE_3DF5F2351C | N-Acetylglutamine | [M+Na]+ | 211.0695 | 144.4 | CC(=O)N[C@@H](CCC(=O)N)C(=O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_5DAE73A0C4 | 3'-O-methylguanosine | [M+Na]+ | 320.0971 | 178.1 | CO[C@@H]1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C2NC(=NC3=O)N)CO | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_B4B1DCB907 | 16-Hydroxypalmitic acid | [M+Na]+ | 295.2249 | 178.2 | C(CCCCCCCC(=O)O)CCCCCCCO | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_F580404309 | D-Mannose 1-phosphate | [M+Na]+ | 283.0195 | 158.3 | C([C@@H]1[C@H]([C@@H]([C@@H](C(O1)OP(=O)(O)O)O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_2CB5B97A19 | 2'-Deoxyinosine 5'-monophosphate | [M+Na]+ | 355.042 | 166.8 | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2NC=NC3=O)COP(=O)(O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_458A56AC66 | Beta-D-Fructose 2-phosphate | [M+Na]+ | 283.0195 | 154.0 | C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)OP(=O)(O)O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_7A9385AA64 | 1-Salicylate glucuronide | [M+Na]+ | 337.0536 | 170.1 | C1=CC=C(C(=C1)C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_B51B0C5F93 | L-Iditol | [M+Na]+ | 205.0688 | 143.0 | C([C@@H]([C@H]([C@@H]([C@H](CO)O)O)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_F091B940D0 | Prephenate | [M+Na]+ | 249.0375 | 155.0 | C1=CC(C=CC1O)(CC(=O)C(=O)O)C(=O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
CCSBASE_957EBCC749 | Arbutin | [M+Na]+ | 295.0794 | 166.6 | C1=CC(=CC=C1O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O | small molecule | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) |