| ID |
Name |
Adduct |
Structure |
m/z |
CCS |
SMI |
Type |
Z |
Ref |
CCS Type |
CCS method |
| CCSBASE_89050f080cfcbca59dd15eb0313ed9d2 |
1,3-Butylene diacrylate |
[M+FA-H]- |
C%3DC)OC(%3DO)C%3DC) |
243.0874 |
154.6 |
CC(CCOC(=O)C=C)OC(=O)C=C |
Organic acids and derivatives |
-1 |
|
TW |
polyala |
| CCSBASE_c8832993dae90aaf3bc180e6f0e368be |
1,3-Butylene diacrylate |
[M-H]- |
C%3DC)OC(%3DO)C%3DC) |
197.0819 |
146.65 |
CC(CCOC(=O)C=C)OC(=O)C=C |
Organic acids and derivatives |
-1 |
|
TW |
polyala |
| CCSBASE_987ea4d5a4f7e4bd904432830d96c30b |
Hexahydro-1,3,5-tris(1-oxoallyl)-1,3,5-triazine |
[M+Cl]- |
N1CN(CN(C1)C(%3DO)C%3DC)C(%3DO)C%3DC) |
284.0807 |
161.7 |
C=CC(=O)N1CN(CN(C1)C(=O)C=C)C(=O)C=C |
Organoheterocyclic compounds |
-1 |
|
TW |
polyala |
| CCSBASE_65b3d391b36bcc7643ce9c69718aaab5 |
Hexahydro-1,3,5-tris(1-oxoallyl)-1,3,5-triazine |
[M+Na]+ |
N1CN(CN(C1)C(%3DO)C%3DC)C(%3DO)C%3DC) |
272.1006 |
157.93 |
C=CC(=O)N1CN(CN(C1)C(=O)C=C)C(=O)C=C |
Organoheterocyclic compounds |
1 |
|
TW |
polyala |
| CCSBASE_078718f509795bde3d7dffc7b6286036 |
2,4,5-Trimethylaniline |
[M+H]+ |
N)C) |
136.1121 |
135.97 |
CC1=CC(=C(C=C1C)N)C |
Benzenoids |
1 |
|
TW |
polyala |
| CCSBASE_84ebc32f6efb9dc69acc8201856d1b35 |
Chlorthiamid |
[M+H]+ |
Cl)C(%3DS)N)Cl) |
205.9593 |
135.77 |
C1=CC(=C(C(=C1)Cl)C(=S)N)Cl |
Benzenoids |
1 |
|
TW |
polyala |
| CCSBASE_7e722b8473358d61f931bf6e25b4fa48 |
1,3-Dihydro-1,3,3-trimethyl-2H-indol-2-ylidene acetaldehyde |
[M+H]+ |
C)C) |
202.1226 |
145.61 |
CC1(C2=CC=CC=C2N(C1=CC=O)C)C |
Organoheterocyclic compounds |
1 |
|
TW |
polyala |
| CCSBASE_93c13995707ea29200d157fe7ae6a6c1 |
Furalaxyl |
[M+Na]+ |
C)N(C(C)C(%3DO)OC)C(%3DO)C2%3DCC%3DCO2) |
324.1206 |
174.4 |
CC1=C(C(=CC=C1)C)N(C(C)C(=O)OC)C(=O)C2=CC=CO2 |
Benzenoids |
1 |
|
TW |
polyala |
| CCSBASE_a38279c61d9ad6905529557d2c195ac4 |
Hexanedihydrazide |
[M+Cl]- |
NN)CC(%3DO)NN) |
209.0811 |
145.44 |
C(CCC(=O)NN)CC(=O)NN |
Organic acids and derivatives |
-1 |
|
TW |
polyala |
| CCSBASE_21e2f98e8aeeb15e22562307e4618119 |
Tetraisopropyl methylenediphosphonate |
[M+K]+ |
OP(%3DO)(CP(%3DO)(OC(C)C)OC(C)C)OC(C)C) |
383.1149 |
184.94 |
CC(C)OP(=O)(CP(=O)(OC(C)C)OC(C)C)OC(C)C |
Organic acids and derivatives |
1 |
|
TW |
polyala |