Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_DCA949BBF0 | perfluorodecane sulfonic acid | [M-H]- | 598.9238 | 186.91 | C(C(C(C(C(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_D037BD80A1 | Perfluorodecylphosponic acid | [M-H]- | 598.9333 | 188.25 | C(C(C(C(C(C(F)(F)P(=O)(O)O)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_A9550D6468 | perfluorohexanesulfonic acid | [M-H]- | 398.9366 | 150.81 | C(C(C(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_60CDA14459 | perfluorohexanesulfonic acid | [2M-H]- | 798.8805 | 228.66 | None | None | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_A7673B807F | Perfluoro-n-butanoic acid | [M-H-CO2]- | 168.9894 | 109.53 | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_DD5B4B06BC | Perfluoro-n-decanoic acid | [M-H]- | 512.96 | 174.29 | C(=O)(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_51345DB96F | Perfluoro-n-decanoic acid | [2M-H]- | 1026.9273 | 254.24 | C(=O)(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | None | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_BEAE155001 | Perfluoro-n-decanoic acid | [M-H-CO2]- | 468.9702 | 155.63 | C(=O)(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_75E38A9460 | Perfluoro-n-dodecanoic acid | [M-H]- | 612.9536 | 192.16 | C(=O)(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_23C5DEE820 | Perfluoro-n-dodecanoic acid | [2M-H]- | 1226.9145 | 278.8 | C(=O)(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | None | -1 | 24 | DT | single field, calibrated |