Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_B245E8E281 | Mono-isononyl-cyclohexane-1,2-dicarboxylate | [M+Na]+ | 321.2036 | 185.87 | CCCCC(C)CCCOC(=O)[C@@H]1CCCC[C@@H]1C(=O)O | Benzenoids | 1 | 24 | DT | single field, calibrated | |
| CCSBASE_22754CF8F8 | Mono-isononyl-cyclohexane-1,2-dicarboxylate | [M-H]- | 297.2071 | 175.48 | CCCCC(C)CCCOC(=O)[C@@H]1CCCC[C@@H]1C(=O)O | Benzenoids | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_98216413DE | Mono-methyl phthalate | [M+Na]+ | 203.0315 | 146.13 | COC(=O)C1=CC=CC=C1C(=O)O | Benzenoids | 1 | 24 | DT | single field, calibrated | |
| CCSBASE_6F2CEBD75E | Mono-methyl phthalate | [M-H]- | 179.035 | 137.01 | COC(=O)C1=CC=CC=C1C(=O)O | Benzenoids | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_61553F3772 | Mono-n-butyl phthalate | [M+Na]+ | 245.0784 | 163.94 | CCCCOC(=O)C1=CC=CC=C1C(=O)O | Benzenoids | 1 | 24 | DT | single field, calibrated | |
| CCSBASE_C0A60A886D | Mono-n-butyl phthalate | [M-H]- | 221.0819 | 151.11 | CCCCOC(=O)C1=CC=CC=C1C(=O)O | Benzenoids | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_15881F76A7 | N-ethylperfluorooctane sulfonamido acetic acid | [M-H]- | 583.983 | 196.81 | CCN(CC(=O)O)S(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_A9281154BA | N-ethylperfluorooctane sulfonamido acetic acid | [2M-H]- | 1168.9732 | 283.56 | CCN(CC(=O)O)S(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F | None | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_7C377E660E | N-ethylperfluorooctanesulfonamide | [M-H]- | 525.9775 | 178.42 | CCNS(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_DCFF66F9B7 | N-Methylperfluorooctane sulfonamide | [M-H]- | 511.9619 | 173.97 | CNS(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F | Organohalogen compounds | -1 | 24 | DT | single field, calibrated |