Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_4A56611032 | Perfluoro-n-dodecanoic acid | [M-H-CO2]- | 568.9638 | 172.25 | C(=O)(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_60238473CD | Perfluoro-n-heptanoic acid | [M-H]- | 362.9696 | 147.61 | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_0438AE4C6D | Perfluoro-n-heptanoic acid | [2M-H]- | 726.9465 | 211.59 | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | None | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_DB5BCB645C | Perfluoro-n-heptanoic acid | [M-H-CO2]- | 318.9798 | 132.3 | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_1C6B45CD13 | Perfluoro-n-hexadecanoic acid | [M-H]- | 812.9409 | 227.34 | C(=O)(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Lipids and lipid-like molecules | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_EC621A6B0A | Perfluoro-n-hexadecanoic acid | [2M-H]- | 1626.8891 | 325.43 | C(=O)(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | None | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_8BA08B9691 | Perfluoro-n-hexadecanoic acid | [M-H-CO2]- | 768.9511 | 204.5 | C(=O)(C(C(C(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Lipids and lipid-like molecules | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_CF65D6A248 | Perfluoro-n-hexanoic acid | [2M-H]- | 626.9529 | 195.94 | C(=O)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)O | None | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_277F67B13C | Perfluoro-n-hexanoic acid | [M-H-CO2]- | 268.983 | 124.47 | C(=O)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Organohalogen compounds | -1 | 24 | DT | single field, calibrated | |
| CCSBASE_35417D9574 | Perfluoro-n-nonanoic acid | [M-H]- | 462.9632 | 165.06 | C(=O)(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O | Organohalogen compounds | -1 | 24 | DT | single field, calibrated |