Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
Upload a CSV file
| ID | Name | Adduct | Structure | m/z | RT | CCS | SMI | Type | Z | Ref | CCS Type | CCS method | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_05d4a0c0957375ade83c15913842d0d6 | Dexamethasone sodium phosphate | [M+Na]+ | 495.1555 | 0.89 | 207.0 | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COP(=O)([O-])[O-])O)C)O)F)C | Lipids and lipid-like molecules | 1 | 1 | TW | polyala | ||
| CCSBASE_ad25a16e94b1a162dd802432368fa481 | Dexamethasone sodium phosphate | [M-H]- | 471.1589 | 0.88 | 201.41 | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COP(=O)([O-])[O-])O)C)O)F)C | Lipids and lipid-like molecules | -1 | 1 | TW | polyala | ||
| CCSBASE_9ed3fac11302522dafc3cd8f59467241 | 2,2',2'',2'''-(1,2-Ethanediyldinitrilo)tetrakisethanol | [M+H]+ | 237.1809 | 0.25 | 149.94 | C(CN(CCO)CCO)N(CCO)CCO | Organic nitrogen compounds | 1 | 1 | TW | polyala | ||
| CCSBASE_726ed1e261652be81fc19272d38d9bf0 | Methyl hexanedioate | [M-H]- | 159.0663 | 0.73 | 136.27 | COC(=O)CCCCC(=O)O | Lipids and lipid-like molecules | -1 | 1 | TW | polyala | ||
| CCSBASE_3c93606bdb092b5e40732bd73d75bdef | Clomazone | [M+H]+ | 240.0786 | 0.89 | 148.69 | CC1(CON(C1=O)CC2=CC=CC=C2Cl)C | Benzenoids | 1 | 1 | TW | polyala | ||
| CCSBASE_c7d0bebd82e79ff8eda370ab22ec8a1a | Clomazone | [M+Na]+ | 262.0605 | 0.89 | 158.96 | CC1(CON(C1=O)CC2=CC=CC=C2Cl)C | Benzenoids | 1 | 1 | TW | polyala | ||
| CCSBASE_d98c9d6a54be3781999e1de5b0466816 | Propanil | [M+H]+ | 218.0134 | 0.9 | 145.46 | CCC(=O)NC1=CC(=C(C=C1)Cl)Cl | Benzenoids | 1 | 1 | TW | polyala | ||
| CCSBASE_0aba1027c110abd4490b38ab73214af2 | Propanil | [M-H]- | 215.9988 | 0.85 | 145.53 | CCC(=O)NC1=CC(=C(C=C1)Cl)Cl | Benzenoids | -1 | 1 | TW | polyala | ||
| CCSBASE_28bc074749e7e0faf4fddc305c86f146 | Diisobutyl succinate | [M+Na]+ | 253.141 | 0.95 | 169.11 | CC(C)COC(=O)CCC(=O)OCC(C)C | Lipids and lipid-like molecules | 1 | 1 | TW | polyala | ||
| CCSBASE_89d10a75e563852cc1b515d154a74320 | Diisobutyl succinate | [M-H]- | 229.1445 | 0.84 | 156.57 | CC(C)COC(=O)CCC(=O)OCC(C)C | Lipids and lipid-like molecules | -1 | 1 | TW | polyala |