Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
Upload a CSV file
| ID | Name | Adduct | Structure | m/z | RT | CCS | SMI | Type | Z | Ref | CCS Type | CCS method | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_f91818e3dbca36395c3fd45d3760a335 | Decyl prop-2-enoate | [M+FA-H]- | 257.1758 | 0.9 | 164.96 | CCCCCCCCCCOC(=O)C=C | Lipids and lipid-like molecules | -1 | 1 | TW | polyala | ||
| CCSBASE_78539509b6d877c7c42b94b2e9dfd16f | Pentaerythritol tetraacrylate | [M+Na]+ | 375.105 | 0.84 | 177.76 | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C | Organic acids and derivatives | 1 | 1 | TW | polyala | ||
| CCSBASE_3a3c847a2fd07b079d37d62309befb89 | CP-471358 | [M+K]+ | 505.0842 | 0.83 | 208.28 | C1CCC(C1)(C(=O)NO)N(CCC(=O)O)S(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)F | Benzenoids | 1 | 1 | TW | polyala | ||
| CCSBASE_cca6b6ea4c874d251fb5b57bf9f75058 | CP-471358 | [M+Na]+ | 489.1102 | 0.83 | 206.08 | C1CCC(C1)(C(=O)NO)N(CCC(=O)O)S(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)F | Benzenoids | 1 | 1 | TW | polyala | ||
| CCSBASE_4f562003b1b3d18eae579ef593355b21 | CP-471358 | [M-H]- | 465.1137 | 0.79 | 199.45 | C1CCC(C1)(C(=O)NO)N(CCC(=O)O)S(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)F | Benzenoids | -1 | 1 | TW | polyala | ||
| CCSBASE_4964ec7afab27173e734f6ddbfcd357f | 1-Decanamine | [M+H]+ | 158.1903 | 0.8 | 157.7 | CCCCCCCCCCN | Organic nitrogen compounds | 1 | 1 | TW | polyala | ||
| CCSBASE_63b4f8581f3c0de20b9bd09897bba69d | Benzoin | [M+K]+ | 251.0469 | 1.08 | 152.58 | C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)O | Phenylpropanoids and polyketides | 1 | 1 | TW | polyala | ||
| CCSBASE_8f9eeabb0f228da4f47a3f0e93428211 | 2-Hydroxy-2-methylpropiophenone | [M+FA-H]- | 209.0819 | 0.76 | 145.58 | CC(C)(C(=O)C1=CC=CC=C1)O | Organic oxygen compounds | -1 | 1 | TW | polyala | ||
| CCSBASE_f733e7b838f6f51c70018ee500a2f0c0 | Tetradecanoic acid, 2,3-dihydroxypropyl ester | [M+H-H2O]+ | 285.2425 | 1.08 | 185.23 | CCCCCCCCCCCCCC(=O)OCC(CO)O | Lipids and lipid-like molecules | 1 | 1 | TW | polyala | ||
| CCSBASE_331e19298b1ec0787597206585a378fd | Tetradecanoic acid, 2,3-dihydroxypropyl ester | [M+Na]+ | 325.2349 | 1.09 | 187.54 | CCCCCCCCCCCCCC(=O)OCC(CO)O | Lipids and lipid-like molecules | 1 | 1 | TW | polyala |