Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_3A1BACC9A9 | Betaine aldehyde | [M+H]+ | 102.0919 | 117.2 | C[N+](C)(C)CC=O | None | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_6C9337611D | Spermine | [M+H]+ | 203.2235 | 148.2 | C(CCNCCCN)CNCCCN | Organic nitrogen compounds | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_F3CAAA65B5 | Spermidine | [M+H]+ | 146.1657 | 131.9 | C(CCNCCCN)CN | Organic nitrogen compounds | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_EEE79AE7BF | cGMP | [M+H]+ | 346.0552 | 172.8 | C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C3N=C(NC4=O)N)O)OP(=O)(O1)O | Nucleosides, nucleotides, and analogues | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_D109E8B0B6 | Pyridoxine 5-phosphate | [M+H]+ | 250.048 | 150.5 | CC1=NC=C(C(=C1O)CO)COP(=O)(O)O | Organoheterocyclic compounds | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_204EB7AD69 | Oleoyl-CoA | [M+H]+ | 1032.3683 | 299.4 | CCCCCCCC/C=C\CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O | Lipids and lipid-like molecules | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_DD197D488E | N6,N6,N6-Trimethyl-L-lysine | [M+H]+ | 189.1603 | 142.0 | C[N+](C)(C)CCCC[C@@H](C(=O)[O-])N | Organic acids and derivatives | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_83268C2247 | Prostaglandin I2 | [M+H]+ | 353.2328 | 198.6 | CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@H]2[C@@H]1C/C(=C/CCCC(=O)O)/O2)O)O | Lipids and lipid-like molecules | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_7D83F28D43 | Palmitoyl CoA | [M+H]+ | 1006.3527 | 296.2 | CCCCCCCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O | Lipids and lipid-like molecules | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_FA276131D7 | Glutaryl-CoA | [M+H]+ | 882.1547 | 260.5 | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)[C@H](C(=O)NCCC(=O)NCCSC(=O)CCCC(=O)O)O | Lipids and lipid-like molecules | 1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) |