Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_5D754015D1 | Mevalonic acid | [M+Na]+ | 171.0633 | 128.0 | CC(CCO)(CC(=O)O)O | Lipids and lipid-like molecules | 1 | 2 | TW | calibrated with polyalanine | |
| CCSBASE_B021150FD3 | Arginine | [M+H]+ | 175.1195 | 133.0 | C(C[C@@H](C(=O)O)N)CN=C(N)N | Organic acids and derivatives | 1 | 2 | TW | calibrated with polyalanine | |
| CCSBASE_D9B4F11F87 | Citrulline | [M+H]+ | 176.1035 | 132.0 | C(C[C@@H](C(=O)O)N)CNC(=O)N | Organic acids and derivatives | 1 | 2 | TW | calibrated with polyalanine | |
| CCSBASE_4D2FAF6D1D | Glucosamine | [M+H]+ | 180.0872 | 135.0 | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)N)O)O)O | Organic oxygen compounds | 1 | 2 | TW | calibrated with polyalanine | |
| CCSBASE_04711A3F00 | Tyrosine | [M+H]+ | 182.0817 | 139.0 | C1=CC(=CC=C1C[C@@H](C(=O)O)N)O | Organic acids and derivatives | 1 | 2 | TW | calibrated with polyalanine | |
| CCSBASE_97D8CFC77D | Pyridoxic acid | [M+H]+ | 184.061 | 130.0 | CC1=NC=C(C(=C1O)C(=O)O)CO | Organoheterocyclic compounds | 1 | 2 | TW | calibrated with polyalanine | |
| CCSBASE_15CD4151BA | Phosphorylcholine | [M+H]+ | 184.0738 | 135.0 | C[N+](C)(C)CCOP(=O)(O)[O-] | Organic nitrogen compounds | 1 | 2 | TW | calibrated with polyalanine | |
| CCSBASE_6610AA1DA8 | Epinephrine | [M+H]+ | 184.0973 | 133.0 | CNCC(C1=CC(=C(C=C1)O)O)O | Benzenoids | 1 | 2 | TW | calibrated with polyalanine | |
| CCSBASE_D4BC7A0B16 | Phosphoenolpyruvate | [M+Na]+ | 190.9721 | 131.0 | C=C(C(=O)O)OP(=O)(O)O | Organic acids and derivatives | 1 | 2 | TW | calibrated with polyalanine | |
| CCSBASE_712850947A | Glycerol monophosphate | [M+Na]+ | 195.0034 | 132.0 | C([C@H](COP(=O)(O)O)O)O | Lipids and lipid-like molecules | 1 | 2 | TW | calibrated with polyalanine |