Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_372438D6C7 | PYRROMYCIN | [M+H]+ | 586.2283 | 233.9 | CC[C@]1(C[C@@H](C2=C(C3=C(C=C2[C@H]1C(=O)OC)C(=O)C4=C(C=CC(=C4C3=O)O)O)O)O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O)N(C)C)O | Phenylpropanoids and polyketides | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_3C076D2749 | IPRATROPIUM BROMIDE | [M+H]+ | 333.2299 | 179.8 | CC(C)[N+]1(C)C2CCC1CC(OC(=O)C(CO)c1ccccc1)C2 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_8E36754781 | THIAMINE | [M+H]+ | 265.1123 | 155.9 | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_E0C47D2255 | PENTETIC ACID | [M+H]+ | 394.1456 | 180.2 | C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O | Organic acids and derivatives | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_34AB0D59E4 | FURAZOLIDONE | [M]+ | 225.0386 | 144.2 | C1COC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_635C8AD5E7 | CHOLINE CHLORIDE | [M]+ | 104.1075 | 121.0 | C[N+](C)(C)CCO | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_A89216AA71 | FLUOCINOLONE ACETONIDE | [M+H]+ | 453.2083 | 199.7 | C[C@]12C[C@@H]([C@]3([C@H]([C@@H]1C[C@@H]4[C@]2(OC(O4)(C)C)C(=O)CO)C[C@@H](C5=CC(=O)C=C[C@@]53C)F)F)O | Lipids and lipid-like molecules | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_B2BACB56DE | TRIAMCINOLONE DIACETATE | [M+H]+ | 479.2076 | 209.5 | CC(=O)OCC(=O)[C@]1([C@@H](C[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)O)C)OC(=O)C)O | Lipids and lipid-like molecules | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_82F9521F83 | DICYCLOMINE HYDROCHLORIDE | [M+H]+ | 310.2741 | 179.1 | CCN(CC)CCOC(=O)C1(C2CCCCC2)CCCCC1 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_0F7B7D1984 | DEXTROMETHORPHAN HYDROBROMIDE | [M+H]+ | 272.2009 | 165.2 | COc1ccc2c(c1)C13CCCCC1C(C2)N(C)CC3 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards |