Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_6B00CCEF6C | MELOXICAM SODIUM | [M+H]+ | 352.0425 | 174.5 | Cc1cnc(NC(=O)C2=C([O-])c3ccccc3S(=O)(=O)N2C)s1 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_BE5E39C5FF | CEFONICID SODIUM | [M+Na]+ | 565.024 | 205.7 | O=C([O-])C1=C(CSc2nnnn2CS(=O)(=O)[O-])CSC2C(NC(=O)C(O)c3ccccc3)C(=O)N12 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_1F406F8889 | NAFCILLIN SODIUM | [M+H]+ | 415.1322 | 191.5 | CCOc1ccc2ccccc2c1C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)[O-] | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_0B74676B78 | LINCOMYCIN HYDROCHLORIDE | [M+H]+ | 407.2211 | 199.1 | CCCC1CC(C(=O)NC(C(C)O)C2OC(SC)C(O)C(O)C2O)N(C)C1 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_67A592446F | SULFATHIAZOLE | [M+H]+ | 256.0209 | 150.8 | C1=CC(=CC=C1N)S(=O)(=O)NC2=NC=CS2 | Benzenoids | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_3F62F31E47 | SULFAMETHOXAZOLE | [M+H]+ | 254.0594 | 151.4 | CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N | Benzenoids | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_E8D82553A0 | OXACILLIN SODIUM | [M+H]+ | 402.1118 | 189.0 | Cc1onc(-c2ccccc2)c1C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)[O-] | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_52B207BC3E | MIGLITOL | [M+H]+ | 208.118 | 141.0 | C1[C@@H]([C@H]([C@@H]([C@H](N1CCO)CO)O)O)O | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_DE4AD3E87A | ANIRACETAM | [M+H]+ | 220.0968 | 146.6 | COC1=CC=C(C=C1)C(=O)N2CCCC2=O | Benzenoids | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_63B3FDCF8B | METHICILLIN SODIUM | [M+H]+ | 381.1115 | 183.7 | COc1cccc(OC)c1C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)[O-] | None | 1 | 7 | TW | calibrated with polyalanine and drug standards |