Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_5EA5F5C3B7 | 2',4-DIHYDROXYCHALCONE | [M+H]+ | 241.0859 | 153.0 | C1=CC=C(C(=C1)C(=O)/C=C/C2=CC=C(C=C2)O)O | Phenylpropanoids and polyketides | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_1A2847ABB3 | FENOTEROL HYDROBROMIDE | [M+H]+ | 304.1544 | 170.0 | CC(Cc1ccc(O)cc1)NCC(O)c1cc(O)cc(O)c1 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_25C8E9C92F | ERYTHROMYCIN ESTOLATE | [M+H]+ | 790.4953 | 264.4 | None | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_CEB8170224 | DIETHYLTOLUAMIDE | [M+H]+ | 192.1383 | 143.2 | CCN(CC)C(=O)C1=CC=CC(=C1)C | Benzenoids | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_BFEFD911D7 | RACEPHEDRINE HYDROCHLORIDE | [M+H]+ | 166.1227 | 136.1 | CNC(C)C(O)c1ccccc1 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_ECFEAD8190 | DICLOXACILLIN SODIUM | [M+Na]+ | 492.0158 | 202.7 | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)[O-] | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_819E9BD88E | N-METHYLBENZYLAMINE HYDROCHLORIDE | [M+H]+ | 122.0964 | 124.5 | CNCc1ccccc1 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_30DCD85BF5 | ACTINONIN | [M+H]+ | 386.265 | 194.1 | CCCCC[C@H](CC(=O)NO)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1CO | Organic acids and derivatives | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_A990FBF256 | ATORVASTATIN CALCIUM | [M+H]+ | 559.2603 | 231.5 | None | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_6B3C676A0F | TRANYLCYPROMINE SULFATE | [M+H]+ | 134.0964 | 127.2 | None | None | 1 | 7 | TW | calibrated with polyalanine and drug standards |