| ID |
Name |
Adduct |
Structure |
m/z |
CCS |
SMI |
Type |
Z |
Ref |
CCS Type |
CCS method |
| CCSBASE_a0d0b18aa006e648182bc54cab14373c |
3-(Dodecenyl)dihydro-2,5-furandione |
[M+H-H2O]+ |
OC1%3DO) |
249.185 |
163.92 |
CCCCCCCCCCC=CC1CC(=O)OC1=O |
Organic acids and derivatives |
1 |
|
TW |
polyala |
| CCSBASE_81fb3c14df8a17ed960cbcedfcc9f312 |
Fenoxaprop-ethyl |
[M+H]+ |
C(C)OC1%3DCC%3DC(C%3DC1)OC2%3DNC3%3DC(O2)C%3DC(C%3DC3)Cl) |
362.079 |
187.78 |
CCOC(=O)C(C)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl |
Benzenoids |
1 |
|
TW |
polyala |
| CCSBASE_48a24976d4bdbce48f008e08c7b9e3ab |
Fenoxaprop-ethyl |
[M+Na]+ |
C(C)OC1%3DCC%3DC(C%3DC1)OC2%3DNC3%3DC(O2)C%3DC(C%3DC3)Cl) |
384.0609 |
184.46 |
CCOC(=O)C(C)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl |
Benzenoids |
1 |
|
TW |
polyala |
| CCSBASE_52bfec9f7a589742b301840e2b354f99 |
3,5,5-Trimethylhexyl acetate |
[M+Na]+ |
C)CC(C)(C)C) |
209.1512 |
152.91 |
CC(CCOC(=O)C)CC(C)(C)C |
Organic acids and derivatives |
1 |
|
TW |
polyala |
| CCSBASE_54fe823e3032a5408dc0580495c40bc8 |
2,2'-Methylenebis(ethyl-6-tert-butylphenol) |
[M+Na]+ |
C(C)(C)C)O)CC2%3DC(C(%3DCC(%3DC2)CC)C(C)(C)C)O) |
391.2607 |
200.17 |
CCC1=CC(=C(C(=C1)C(C)(C)C)O)CC2=C(C(=CC(=C2)CC)C(C)(C)C)O |
Benzenoids |
1 |
|
TW |
polyala |
| CCSBASE_0ef98e63490ac96cfaeae304b4ccb57c |
2,2'-Methylenebis(ethyl-6-tert-butylphenol) |
[M-H]- |
C(C)(C)C)O)CC2%3DC(C(%3DCC(%3DC2)CC)C(C)(C)C)O) |
367.2642 |
207.3 |
CCC1=CC(=C(C(=C1)C(C)(C)C)O)CC2=C(C(=CC(=C2)CC)C(C)(C)C)O |
Benzenoids |
-1 |
|
TW |
polyala |
| CCSBASE_a2ae7bde4541f1fd7c272ff53ea3634d |
Timolol maleate salt |
[M+H]+ |
(C)NCC(COC1%3DNSN%3DC1N2CCOCC2)O) |
317.1642 |
174.85 |
CC(C)(C)NCC(COC1=NSN=C1N2CCOCC2)O |
Organic nitrogen compounds |
1 |
|
TW |
polyala |
| CCSBASE_e4e501f923c0a7cd2ff1616e03d57955 |
3,6,9,12-Tetraoxatetradeca-1,13-diene |
[M+Na]+ |
 |
225.1097 |
144.91 |
C=COCCOCCOCCOC=C |
Organic oxygen compounds |
1 |
|
TW |
polyala |
| CCSBASE_fc99a170ce56efc74107e10cdf86714d |
Sodium 2,5-dimethylbenzenesulfonate |
[M-H]- |
C)S(%3DO)(%3DO)%5BO-%5D) |
185.0278 |
141.84 |
CC1=CC(=C(C=C1)C)S(=O)(=O)[O-] |
Benzenoids |
-1 |
|
TW |
polyala |
| CCSBASE_502e037747a02d9b8d5e3b9e306edee5 |
N-Methylphthalimide |
[M+H]+ |
C2%3DCC%3DCC%3DC2C1%3DO) |
162.055 |
127.51 |
CN1C(=O)C2=CC=CC=C2C1=O |
Organoheterocyclic compounds |
1 |
|
TW |
polyala |