| ID |
Name |
Adduct |
Structure |
m/z |
CCS |
SMI |
Type |
Z |
Ref |
CCS Type |
CCS method |
| CCSBASE_009d8fc29f90560028e6b8d478347fde |
Nalidixic acid |
[M+H-H2O]+ |
C2%3DC1N%3DC(C%3DC2)C)C(%3DO)O) |
215.0816 |
143.49 |
CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)O |
Organoheterocyclic compounds |
1 |
|
TW |
polyala |
| CCSBASE_cc4af1b981944bcc2c3de07c41b9c8bf |
Nalidixic acid |
[M+Na]+ |
C2%3DC1N%3DC(C%3DC2)C)C(%3DO)O) |
255.074 |
159.15 |
CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)O |
Organoheterocyclic compounds |
1 |
|
TW |
polyala |
| CCSBASE_caca03d0cc7eba5f32eae58f7892cf51 |
Benzylhexadecyldimethylammonium chloride |
[M]+ |
(C)CC1%3DCC%3DCC%3DC1) |
360.3625 |
213.74 |
CCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 |
Benzenoids |
1 |
|
TW |
polyala |
| CCSBASE_3892b28945036455a82cc821f3f0acbe |
Allyl isovalerate |
[M+FA-H]- |
CC(%3DO)OCC%3DC) |
187.0976 |
143.94 |
CC(C)CC(=O)OCC=C |
Lipids and lipid-like molecules |
-1 |
|
TW |
polyala |
| CCSBASE_cb8721837408569544887864853d0e6e |
1,2,4-Benzenetricarboxylic acid |
[M+H-H2O]+ |
O)C(%3DO)O)C(%3DO)O) |
193.0132 |
133.36 |
C1=CC(=C(C=C1C(=O)O)C(=O)O)C(=O)O |
Organic acids and derivatives |
1 |
|
TW |
polyala |
| CCSBASE_7c4d3995228413d9934c4e747390e668 |
1,2,4-Benzenetricarboxylic acid |
[M-H]- |
O)C(%3DO)O)C(%3DO)O) |
209.0091 |
140.0 |
C1=CC(=C(C=C1C(=O)O)C(=O)O)C(=O)O |
Organic acids and derivatives |
-1 |
|
TW |
polyala |
| CCSBASE_6ffdb18806de64e0691deb027a661282 |
1,2,4-Benzenetricarboxylic acid |
[M-H-H2O]- |
O)C(%3DO)O)C(%3DO)O) |
190.998 |
137.12 |
C1=CC(=C(C=C1C(=O)O)C(=O)O)C(=O)O |
Organic acids and derivatives |
-1 |
|
TW |
polyala |
| CCSBASE_6be3f3ee1091b8f0eafae7a34e976a5a |
BisOPP-A |
[M-H]- |
(C1%3DCC(%3DC(C%3DC1)O)C2%3DCC%3DCC%3DC2)C3%3DCC(%3DC(C%3DC3)O)C4%3DCC%3DCC%3DC4) |
379.1703 |
204.03 |
CC(C)(C1=CC(=C(C=C1)O)C2=CC=CC=C2)C3=CC(=C(C=C3)O)C4=CC=CC=C4 |
Phenylpropanoids and polyketides |
-1 |
|
TW |
polyala |
| CCSBASE_6a3f7fcbaac1757cf066b91a2aeeb614 |
7-Methoxy-3,7-dimethyloctanal |
[M+Na]+ |
(C)OC)CC%3DO) |
209.1512 |
153.2 |
CC(CCCC(C)(C)OC)CC=O |
Organic oxygen compounds |
1 |
|
TW |
polyala |
| CCSBASE_115f286ca5316027b2e7c572be6213f2 |
Prothioconazole |
[M+H]+ |
(CN3C(%3DS)N%3DCN3)O)Cl) |
344.0386 |
169.48 |
C1CC1(C(CC2=CC=CC=C2Cl)(CN3C(=S)N=CN3)O)Cl |
Benzenoids |
1 |
|
TW |
polyala |