Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_291B986BF8 | 3,6-DIMETHOXYFLAVONE | [M+H]+ | 283.0965 | 159.9 | COC1=CC2=C(C=C1)OC(=C(C2=O)OC)C3=CC=CC=C3 | Phenylpropanoids and polyketides | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_592B5706A9 | 3,4'-DIMETHOXYFLAVONE | [M+H]+ | 283.0965 | 159.1 | COC1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)OC | Phenylpropanoids and polyketides | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_70761411DB | 3alpha-HYDROXY-3-DEOXYANGOLENSIC ACID METHYL ESTER | [M+H]+ | 473.2534 | 204.6 | C[C@@]12CCC3C(=C)[C@]1(CC(=O)O[C@H]2C4=COC=C4)O[C@@H]5[C@]3(C(C(C(C5)O)(C)C)CC(=O)OC)C | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_F14ED5A844 | DECAHYDROGAMBOGIC ACID | [M+H]+ | 639.3892 | 251.0 | CC(C)CCCC1(C=CC2=C(C3=C(C(=C2O1)CCC(C)C)OC45C(C3=O)CC6CC4C(OC5(C6O)CCC(C)C(=O)O)(C)C)O)C | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_54A268FB22 | GARCINOLIC ACID | [M+H]+ | 647.3215 | 245.7 | CC(=CCCC1(C=CC2=C(C3=C(C(=C2O1)CC=C(C)C)OC45C(CCC=C4C3=O)C(O[C@@]5(C/C=C(\C)/C(=O)O)C(=O)O)(C)C)O)C)C | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_855348A7A0 | CATECHIN TETRAMETHYLETHER | [M+H]+ | 347.1489 | 174.4 | COC1=C(C=C(C=C1)[C@@H]2[C@H](CC3=C(O2)C=C(C=C3OC)OC)O)OC | Phenylpropanoids and polyketides | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_D9EAB234C5 | ANHYDROBRAZILIC ACID | [M+H]+ | 235.0601 | 143.1 | COC1=CC2=C(C=C1)C(=O)C(=CO2)CC(=O)O | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_65B6BCE6BA | EPICATECHIN PENTAACETATE | [M+H]+ | 501.1392 | 207.3 | CC(=O)O[C@@H]1CC2=C(C=C(C=C2OC(=O)C)OC(=O)C)O[C@@H]1C3=CC(=C(C=C3)OC(=O)C)OC(=O)C | Phenylpropanoids and polyketides | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_046ED8A9AA | DEOXYSAPPANONE B 7,4'-DIMETHYL ETHER | [M+H]+ | 315.1227 | 170.6 | COC1=CC2=C(C=C1)C(=O)C(CO2)CC3=CC(=C(C=C3)OC)O | Phenylpropanoids and polyketides | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_BCCEA39F75 | 2-BENZOYL-5-METHOXYBENZOQUINONE | [M+H]+ | 243.0652 | 145.4 | COC1=CC(=O)C(=CC1=O)C(=O)C2=CC=CC=C2 | Benzenoids | 1 | 7 | TW | calibrated with polyalanine and drug standards |