Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_47DC482AC4 | D-Aspartic acid | [M-H]- | 132.0297 | 116.910037 | C([C@H](C(=O)O)N)C(=O)O | Organic acids and derivatives | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_0B8B568644 | 2'-Deoxyinosine 5'-monophosphate | [M+Na-2H]- | 353.0264 | 161.5893581 | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=CNC3=O)COP(=O)(O)O)O | Nucleosides, nucleotides, and analogues | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_80E712974F | Beta-D-Fructose 2-phosphate | [M-H]- | 259.0219 | 141.5111039 | C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)OP(=O)(O)O)O)O)O | Organic oxygen compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_A795D63319 | 2-Oleoyl-1-palmitoyl-sn-glycero-3-phosphocholine | [M-H]- | 758.57 | 272.1721316 | CCCCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C | None | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_C07D9A5082 | 1-Salicylate glucuronide | [M-H]- | 313.056 | 157.8416018 | C1=CC=C(C(=C1)C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O | Organic oxygen compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_149C69E431 | Ethyl glucuronide | [M-H]- | 221.0662 | 143.9670007 | CCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O)O)O | Organic oxygen compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_01CB41A340 | 1-Methylxanthine | [M-H]- | 165.0413 | 124.2331176 | CN1C(=O)C2=C(NC1=O)N=CN2 | Organoheterocyclic compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_189CD53F91 | 1,7-Dimethyluric acid | [M-H]- | 195.0518 | 134.0575024 | CN1C2=C(NC1=O)NC(=O)N(C2=O)C | Organoheterocyclic compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_EDD0CB354F | 7-Methyluric acid | [M-H]- | 181.0362 | 129.3475347 | CN1C2=C(NC(=O)NC2=O)NC1=O | Organoheterocyclic compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_7970548727 | gamma-L-Glutamyl-L-valine | [M-H]- | 245.1138 | 149.9303068 | CC(C)C(C(=O)O)NC(=O)CCC(C(=O)O)N | Organic acids and derivatives | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) |