Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_D92C07045A | D-Neopterin | [M-H]- | 252.0733 | 150.3074716 | C1=C(N=C2C(=O)NC(=NC2=N1)N)[C@@H]([C@@H](CO)O)O | Organoheterocyclic compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_62C85242F3 | Pelargonic acid | [M-H]- | 157.1229 | 143.3257525 | CCCCCCCCC(=O)O | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_28687FFACD | Pimelic acid | [M-H]- | 159.0658 | 129.2857791 | C(CCC(=O)O)CCC(=O)O | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_FBB4545456 | Phenylpropionylglycine | [M-H]- | 206.0817 | 153.2966666 | C1=CC=C(C=C1)CCC(=O)NCC(=O)O | Organic acids and derivatives | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_F5E4176632 | N-Acetyl-L-tyrosine | [M-H]- | 222.0767 | 149.4415679 | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O | Organic acids and derivatives | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_8B2DD6B59F | Xanthurenic acid | [M-H]- | 204.0297 | 132.5127294 | C1=CC2=C(C(=C1)O)NC(=CC2=O)C(=O)O | Organoheterocyclic compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_4F5246CA1E | Ribothymidine | [M-H]- | 257.0774 | 153.522885 | CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O | Nucleosides, nucleotides, and analogues | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_7FB1752500 | Suberic acid | [M-H]- | 173.0814 | 133.1953304 | C(CCCC(=O)O)CCC(=O)O | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_8909B5050B | Taurodeoxycholic acid | [M-H]- | 498.289 | 204.3683815 | C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_2AA8619C14 | 5alpha-Androstane-3,17-dione | [M-H]- | 287.2011 | 174.3195727 | C[C@]12CCC(=O)C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) |