Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_F10E36AFD2 | Glycodeoxycholic acid | [M-H]- | 448.3063 | 197.8149202 | C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_F7DDF3D401 | Glycochenodeoxycholate | [M-H]- | 448.3063 | 198.8475699 | C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_A982141A8D | Dodecanoic acid | [M-H]- | 199.1698 | 152.5839981 | CCCCCCCCCCCC(=O)O | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_021C0D0AAF | D-Galactarate | [M-H]- | 209.0298 | 130.2370434 | [C@@H]([C@@H]([C@H](C(=O)O)O)O)([C@@H](C(=O)O)O)O | Organic oxygen compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_26BF59B5BE | a-D-Galactose 1-phosphate | [M-H]- | 259.0219 | 145.3204351 | O=P(O)(O)OC1OC(CO)C(O)C(O)C1O | None | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_3082A96B4A | Cholesteryl sulfate | [M-H]- | 465.3039 | 237.0061504 | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C)C | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_8DA1DDED8B | Glutaric acid | [M-H]- | 131.0344 | 120.0797202 | C(CC(=O)O)CC(=O)O | Organic acids and derivatives | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_3BF2C9E380 | D-Glucarate | [M-H]- | 209.0298 | 130.50476 | [C@H]([C@@H]([C@@H](C(=O)O)O)O)([C@H](C(=O)O)O)O | Organic oxygen compounds | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_C8C9135439 | Indolelactic acid | [M-H]- | 204.0661 | 146.5117016 | None | None | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) | |
| CCSBASE_BC3E141683 | Linoleic acid | [M-H]- | 279.2324 | 173.2440901 | CCCCCC=CCC=CCCCCCCCC(=O)O | Lipids and lipid-like molecules | -1 | 4 | DT | single field, calibrated with Agilent tune mix (Agilent) |