Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_2A2FE5BF92 | 4-Hydroxyphenylacetic acid | [M-H]- | 151.0401 | 135.22 | C1=CC(=CC=C1CC(=O)O)O | Benzenoids | -1 | 10 | DT | stepped-field | |
| CCSBASE_8D982117F2 | Dopamine | [M-H]- | 152.0704 | 135.36 | C1=CC(=C(C=C1CCN)O)O | Benzenoids | -1 | 10 | DT | stepped-field | |
| CCSBASE_6289E7198F | D-Saccharic acid | [M-H]- | 209.0303 | 135.7 | [C@H]([C@@H]([C@@H](C(=O)O)O)O)([C@H](C(=O)O)O)O | Organic oxygen compounds | -1 | 10 | DT | stepped-field | |
| CCSBASE_01E44BA1CE | 7-Methylguanine | [M-H]- | 164.0578 | 136.62 | CN1C=NC2=C1C(=O)NC(=N2)N | Organoheterocyclic compounds | -1 | 10 | DT | stepped-field | |
| CCSBASE_7C65C9445D | Kynurenic acid | [M-H]- | 188.0353 | 137.3 | C1=CC=C2C(=C1)C(=O)C=C(N2)C(=O)O | Organoheterocyclic compounds | -1 | 10 | DT | stepped-field | |
| CCSBASE_AE850216D4 | DL-Beta-Hydroxybutyric acid | [M-H]- | 103.0401 | 137.54 | CC(CC(=O)O)O | Organic acids and derivatives | -1 | 10 | DT | stepped-field | |
| CCSBASE_FF995FCCC8 | 2-Hydroxy hippuric acid | [M-H]- | 194.0451 | 138.02 | C1=CC=C(C(=C1)C(=O)NCC(=O)O)O | Benzenoids | -1 | 10 | DT | stepped-field | |
| CCSBASE_CDB0606CE8 | Quinic acid | [M-H]- | 191.0561 | 138.47 | C1[C@H](C([C@@H](CC1(C(=O)O)O)O)O)O | Organic oxygen compounds | -1 | 10 | DT | stepped-field | |
| CCSBASE_6072444FD2 | Mevalonic acid 5-phosphate | [M-H]- | 227.0326 | 140.02 | CC(CCOP(=O)(O)O)(CC(=O)O)O | Organic acids and derivatives | -1 | 10 | DT | stepped-field | |
| CCSBASE_B12A6472E5 | N-Formyl-L-methionine | [M-H]- | 176.0387 | 140.73 | CSCC[C@@H](C(=O)O)NC=O | Organic acids and derivatives | -1 | 10 | DT | stepped-field |