Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_B958460EDE | 8-iso-15R-Prostaglandin F2 alpha | [M+Na]+ | 377.2298294 | 200.7666667 | CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@@H]([C@H]1C/C=C\CCCC(=O)O)O)O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_2B1CC53E4B | Halosulfuron-methyl | [M+Na]+ | 457.030361 | 201.4101856 | CN1C(=C(C(=N1)Cl)C(=O)OC)S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC)OC | Organoheterocyclic compounds | 1 | 10 | DT | stepped-field | |
| CCSBASE_DB49CF3C9D | 2-Methoxyestrone | [M+Na]+ | 323.1617534 | 201.7117981 | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=CC(=C(C=C34)OC)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_772F27A060 | Thromboxane B2 | [M+Na]+ | 393.2240804 | 202.0804358 | CCCCC[C@@H](/C=C/[C@@H]1[C@H]([C@H](CC(O1)O)O)C/C=C\CCCC(=O)O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_3DB276D21E | Prostaglandin H2 | [M+Na]+ | 375.2147322 | 202.6333333 | CCCCC[C@@H](/C=C/[C@H]1[C@H]2C[C@@H]([C@@H]1C/C=C\CCCC(=O)O)OO2)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_359CC18BEE | Melezitose | [M+Na]+ | 527.1582452 | 203.2333333 | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@H]2[C@@H]([C@H](O[C@@]2(CO)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)CO)O)O)O)O)O | Organic oxygen compounds | 1 | 10 | DT | stepped-field | |
| CCSBASE_39B3F4A752 | Carbocyclic Thromboxane A2 | [M+Na]+ | 371.2556486 | 203.6 | CCCCC[C@@H](/C=C/[C@H]1CC2CC(C2)[C@@H]1C/C=C\CCCC(=O)O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_DCDAC4BE94 | Aldosterone | [M+Na]+ | 383.1828818 | 204.0911864 | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@H]4C(=O)CO)C=O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_528D027517 | 6-Ketoprostaglandin F1 alpha | [M+Na]+ | 393.2252964 | 204.1666667 | CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@@H]([C@@H]1CC(=O)CCCCC(=O)O)O)O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_51E7757F36 | B-Cortol | [M+Na]+ | 391.2454786 | 204.593874 | C[C@]12CC[C@H](C[C@H]1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4([C@@H](CO)O)O)C)O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field |