Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_911D60EA96 | 1-Methylguanosine | [M+Na]+ | 320.096532 | 180.7999919 | CN1C(=O)C2=C(N=C1N)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O | Nucleosides, nucleotides, and analogues | 1 | 10 | DT | stepped-field | |
| CCSBASE_BE6DF226BF | Arachidonic Acid (C20:4) | [M+Na]+ | 327.2295 | 180.9675544 | None | None | 1 | 10 | DT | stepped-field | |
| CCSBASE_46A31FED0A | Melibiose | [M+Na]+ | 365.1054242 | 181.135117 | C([C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H](C(O2)O)O)O)O)O)O)O)O | Organic oxygen compounds | 1 | 10 | DT | stepped-field | |
| CCSBASE_095C1D5160 | omega-3 Arachidonic Acid | [M+Na]+ | 327.22999 | 181.1666667 | CC/C=C\\C/C=C\\C/C=C\\C/C=C\\CCCCCCC(=O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_AEA444240C | Maltulose | [M+Na]+ | 365.1054242 | 181.269167 | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@H]([C@@H](CO)O)[C@@H](C(=O)CO)O)O)O)O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_D8E2BDF5C4 | Oleic Acid | [M+Na]+ | 305.2451 | 181.3697045 | CCCCCCCC/C=C\CCCCCCCC(=O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field | |
| CCSBASE_21E5E44F4D | Prunetin | [M+Na]+ | 307.0576882 | 181.4367296 | COC1=CC(=C2C(=C1)OC=C(C2=O)C3=CC=C(C=C3)O)O | Phenylpropanoids and polyketides | 1 | 10 | DT | stepped-field | |
| CCSBASE_F03AEBD877 | Orotic Acid | [M+Na]+ | 179.007 | 181.8666667 | C1=C(NC(=O)NC1=O)C(=O)O | Organoheterocyclic compounds | 1 | 10 | DT | stepped-field | |
| CCSBASE_276422CD40 | Eriodictyol | [M+Na]+ | 311.0526032 | 182.1740048 | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O | Phenylpropanoids and polyketides | 1 | 10 | DT | stepped-field | |
| CCSBASE_7F5FF9C271 | Bishomo-gamma-linolenic Acid | [M+Na]+ | 329.2451 | 183.3804551 | CCCCC/C=C\C/C=C\C/C=C\CCCCCCC(=O)O | Lipids and lipid-like molecules | 1 | 10 | DT | stepped-field |