Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_12061C20A3 | N-PHENYLANTHRANILIC ACID | [M+H]+ | 214.0863 | 144.5 | C1=CC=C(C=C1)NC2=CC=CC=C2C(=O)O | Benzenoids | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_7C46A4E81F | COUMARIN | [M+H]+ | 147.0441 | 122.2 | C1=CC=C2C(=C1)C=CC(=O)O2 | Phenylpropanoids and polyketides | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_B3BD297C41 | NOSCAPINE HYDROCHLORIDE | [M+H]+ | 414.1548 | 193.4 | COc1ccc2c(c1OC)C(=O)OC2C1c2c(cc3c(c2OC)OCO3)CCN1C | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_E1E274486B | SARAFLOXACIN HYDROCHLORIDE | [M+H]+ | 386.1311 | 185.4 | O=C(O)c1cn(-c2ccc(F)cc2)c2cc(N3CCNCC3)c(F)cc2c1=O | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_9CACE688D4 | SARAFLOXACIN HYDROCHLORIDE | [M+H]+ | 386.1311 | 199.3 | O=C(O)c1cn(-c2ccc(F)cc2)c2cc(N3CCNCC3)c(F)cc2c1=O | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_D8207C76EE | ROPINIROLE | [M+H]+ | 261.1962 | 162.5 | CCCN(CCC)CCC1=C2CC(=O)NC2=CC=C1 | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_4BEE9C66E6 | HECOGENIN ACETATE | [M+H]+ | 473.3262 | 223.4 | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(C(=O)C[C@H]5[C@H]4CC[C@@H]6[C@@]5(CC[C@@H](C6)OC(=O)C)C)C)C)OC1 | Lipids and lipid-like molecules | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_95497055C2 | CEFDINIR | [M+H]+ | 396.0431 | 190.5 | C=CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)/C(=N\O)/C3=CSC(=N3)N)SC1)C(=O)O | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_266D4195F9 | SCOPOLETIN | [M+H]+ | 193.0496 | 133.6 | COC1=C(C=C2C(=C1)C=CC(=O)O2)O | Phenylpropanoids and polyketides | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_B314DA599D | ENROFLOXACIN | [M+H]+ | 360.1718 | 190.6 | CCN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4CC4)F | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards |