Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_91DC268871 | CHLOROQUINE DIPHOSPHATE | [M+H]+ | 320.1888 | 175.6 | CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_12AC36721D | CAMYLOFINE DIHYDROCHLORIDE | [M+H]+ | 321.2537 | 183.1 | CCN(CC)CCNC(C(=O)OCCC(C)C)c1ccccc1 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_DF4C83AAD8 | FUROSEMIDE | [M+H]+ | 331.015 | 169.3 | C1=COC(=C1)CNC2=CC(=C(C=C2C(=O)O)S(=O)(=O)N)Cl | Benzenoids | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_19F67B4D3D | MOXISYLYTE HYDROCHORIDE | [M+H]+ | 280.1907 | 166.3 | CC(=O)Oc1cc(C(C)C)c(OCCN(C)C)cc1C | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_1175A8BBF2 | AMINOPTERIN | [M+H]+ | 441.163 | 204.4 | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=NC(=N3)N)N | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_5AF84D518A | PRONETALOL HYDROCHLORIDE | [M+H]+ | 230.154 | 156.5 | CC(C)NCC(O)c1ccc2ccccc2c1 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_437082EAE1 | ISONIAZID | [M+H]+ | 138.0662 | 125.6 | C1=CN=CC=C1C(=O)NN | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_A0711364DE | IPRONIAZID SULFATE | [M+H]+ | 180.1132 | 142.2 | CC(C)NNC(=O)c1ccncc1 | None | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_1A6A8A48A8 | PENTYLENETETRAZOL | [M+H]+ | 139.0978 | 124.5 | C1CCC2=NN=NN2CC1 | Organoheterocyclic compounds | 1 | 7 | TW | calibrated with polyalanine and drug standards | |
| CCSBASE_CC9BFF585A | SULOCTIDIL | [M+H]+ | 338.2512 | 197.3 | CCCCCCCCN[C@@H](C)[C@@H](C1=CC=C(C=C1)SC(C)C)O | Benzenoids | 1 | 7 | TW | calibrated with polyalanine and drug standards |