| ID |
Name |
Adduct |
Structure |
m/z |
CCS |
SMI |
Type |
Z |
Ref |
CCS Type |
CCS method |
| CCSBASE_a6ea09af9882081c0b20d5761f5e0f47 |
N-(4-Methoxyphenyl)-3-oxobutanamide |
[M+H-H2O]+ |
CC(%3DO)NC1%3DCC%3DC(C%3DC1)OC%C2%A0) |
190.0863 |
141.78 |
CC(=O)CC(=O)NC1=CC=C(C=C1)OC |
Benzenoids |
1 |
|
TW |
polyala |
| CCSBASE_aa8bd6c21e3281450f991ccdc5ebc2de |
N-(4-Methoxyphenyl)-3-oxobutanamide |
[M+Na]+ |
CC(%3DO)NC1%3DCC%3DC(C%3DC1)OC%C2%A0) |
230.0788 |
156.88 |
CC(=O)CC(=O)NC1=CC=C(C=C1)OC |
Benzenoids |
1 |
|
TW |
polyala |
| CCSBASE_db053ee2b89b2cd46c4121f2e6322721 |
N-(Alkyl C10-C16)-N,N-dimethylglycine betaine |
[M]+ |
 |
272.259 |
184.19 |
None |
Organic acids and derivatives |
1 |
|
TW |
polyala |
| CCSBASE_751e33fe5aa887a73c5bce2072c631f9 |
N,N'-Dibutylurea |
[M+H]+ |
C(%3DO)N%C2%A0%C2%A0) |
173.1648 |
146.23 |
CCCCN(CCCC)C(=O)N |
Organic acids and derivatives |
1 |
|
TW |
polyala |
| CCSBASE_8061a76e3d1b50bdbc3cb51c6f1a9411 |
N,N-Diethylaniline |
[M+H]+ |
C1%3DCC%3DCC%3DC1%C2%A0) |
150.1277 |
131.69 |
CCN(CC)C1=CC=CC=C1 |
Organic nitrogen compounds |
1 |
|
TW |
polyala |
| CCSBASE_b2d31f0c57d369010e54bf817ed9e308 |
N,N-Dimethyl-4-nitrosoaniline |
[M+H]+ |
C1%3DCC%3DC(C%3DC1)N%3DO) |
151.0866 |
127.13 |
CN(C)C1=CC=C(C=C1)N=O |
Organic nitrogen compounds |
1 |
|
TW |
polyala |
| CCSBASE_2f49fd4f3681b23dfac36c79e2bca4d0 |
N,N-Dimethyl-4-nitrosoaniline |
[M+H-H2O]+ |
C1%3DCC%3DC(C%3DC1)N%3DO) |
133.0761 |
126.98 |
CN(C)C1=CC=C(C=C1)N=O |
Organic nitrogen compounds |
1 |
|
TW |
polyala |
| CCSBASE_dac9256e636344858ab3fc7e04b3eba1 |
N,N'-Ethylenedi-L-aspartic acid |
[M-H-H2O]- |
O)C(%3DO)O)NC(CC(%3DO)O)C(%3DO)O) |
273.0723 |
157.84 |
C(CNC(CC(=O)O)C(=O)O)NC(CC(=O)O)C(=O)O |
Organic acids and derivatives |
-1 |
|
TW |
polyala |
| CCSBASE_6de33507f9ee8430562cb30474d325ad |
N-[3-(Dimethylamino)propyl]dodecanamide |
[M+H]+ |
NCCCN(C)C%C2%A0) |
285.29 |
187.12 |
CCCCCCCCCCCC(=O)NCCCN(C)C |
Lipids and lipid-like molecules |
1 |
|
TW |
polyala |
| CCSBASE_588925ca7c91dc29bc331af021b97874 |
N-[3-(Dimethylamino)propyl]dodecanamide |
[M+Na]+ |
NCCCN(C)C%C2%A0) |
307.272 |
190.4 |
CCCCCCCCCCCC(=O)NCCCN(C)C |
Lipids and lipid-like molecules |
1 |
|
TW |
polyala |