Make a CSV file containing information about your queries.
Then upload the CSV file below and click on "Make Queries" to view the results online
and click "Download Results" to download the entire results in one
excel file.
An example of the CSV file can be found below
**Make sure the header column names are as follows**
| ID | Name | Adduct | Structure | m/z | CCS | SMI | Type | Z | Ref | CCS Type | CCS method |
|---|---|---|---|---|---|---|---|---|---|---|---|
| CCSBASE_2A06665EEA | Deferoxamine | [M+Na]+ | 583.3432 | 228.9 | CC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCN)O)O)O | Organic acids and derivatives | 1 | 25 | DT | single field, calibrated | |
| CCSBASE_66C067C12C | Deferoxamine | [M+K]+ | 599.3171 | 229.3 | CC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCN)O)O)O | Organic acids and derivatives | 1 | 25 | DT | single field, calibrated | |
| CCSBASE_5441D41719 | Pyrazinamide | [M+K]+ | 162.007 | 133.2 | C1=CN=C(C=N1)C(=O)N | Organoheterocyclic compounds | 1 | 25 | DT | single field, calibrated | |
| CCSBASE_383A2C4D34 | Strychnine | [M+H]+ | 335.1759 | 171.0 | C1CN2CC3=CCOC4CC(=O)N5C6C4C3CC2C61C7=CC=CC=C75 | Alkaloids and derivatives | 1 | 25 | DT | single field, calibrated | |
| CCSBASE_ED39708412 | Strychnine | [M+Na]+ | 357.1579 | 179.1 | C1CN2CC3=CCOC4CC(=O)N5C6C4C3CC2C61C7=CC=CC=C75 | Alkaloids and derivatives | 1 | 25 | DT | single field, calibrated | |
| CCSBASE_99F212F6C2 | Strychnine | [M+H-H2O]+ | 317.1653 | 168.9 | C1CN2CC3=CCOC4CC(=O)N5C6C4C3CC2C61C7=CC=CC=C75 | Alkaloids and derivatives | 1 | 25 | DT | single field, calibrated | |
| CCSBASE_04A15ADE7E | Pyrilamine | [M+H]+ | 286.1919 | 166.9 | CN(C)CCN(CC1=CC=C(C=C1)OC)C2=CC=CC=N2 | Benzenoids | 1 | 25 | DT | single field, calibrated | |
| CCSBASE_C1B3B7749F | Pyrilamine | [M+Na]+ | 308.1739 | 164.8 | CN(C)CCN(CC1=CC=C(C=C1)OC)C2=CC=CC=N2 | Benzenoids | 1 | 25 | DT | single field, calibrated | |
| CCSBASE_2193E59CB0 | Pyrilamine | [M+K]+ | 324.1478 | 168.5 | CN(C)CCN(CC1=CC=C(C=C1)OC)C2=CC=CC=N2 | Benzenoids | 1 | 25 | DT | single field, calibrated | |
| CCSBASE_8171C972EE | Pyrilamine | [M+H-H2O]+ | 268.1813 | 158.9 | CN(C)CCN(CC1=CC=C(C=C1)OC)C2=CC=CC=N2 | Benzenoids | 1 | 25 | DT | single field, calibrated |